রেনিটিডিন

উইকিপিডিয়া, মুক্ত বিশ্বকোষ থেকে
পরিভ্রমণে ঝাঁপ দিন অনুসন্ধানে ঝাঁপ দিন

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458460406

| IUPAC_name = N-(2-[(5-[(dimethylamino)methyl]furan-2-yl)methylthio]ethyl)-N'-methyl-2-nitroethene-1,1-diamine

| image = Ranitidine.svg

| width = 250

| image2 = File:Ranitidine-A-3D-balls.png


| pronounce = /rəˈnɪt[অসমর্থিত ইনপুট: 'ɨ']dn/

| tradename = রেনিটিড, নিওট্যাক, ইনসিয়াক ইত্যাদি।

| Drugs.com = মনোগ্রাফ

| MedlinePlus = a601106

| licence_US = Ranitidine

| pregnancy_AU = B1

| pregnancy_US = B

| legal_AU = S2

| legal_US_comment = OTC/RX

| legal_UK_comment = P/POM

| routes_of_administration = মুখে, শিরায়


| bioavailability = ৩৯-৮৮%

| protein_bound = ১৫%

| metabolism = লিভার

| elimination_half-life = ২–৩ ঘন্টা

| excretion = ৩০–৭০% বৃক্কীয়


| CAS_number_Ref =  YesY

| CAS_number = 66357-35-5

| ATC_prefix = A02

| ATC_suffix = BA02

| ATC_supplemental =
A02BA07 (ranitidine bismuth citrate)

| IUPHAR_ligand = 1234

| DrugBank_Ref =  YesY

| DrugBank = DB00863

| PubChem = 3001055

| ChemSpiderID = 4863

| UNII_Ref =  YesY

| UNII = 884KT10YB7

| KEGG_Ref =  YesY

| KEGG = D00422

| ChEBI_Ref =  N

| ChEBI = 8776

| ChEMBL_Ref =  N

| ChEMBL = 1790041

| synonyms = Dimethyl [(5-{[(2-{[1-(methylamino)-
2-nitroethenyl]amino}ethyl)sulfanyl]
methyl}furan-2-yl)methyl]amine


| C=13 | H=22 | N=4 | O=3 | S=1

| molecular_weight = ৩১৪.৪ g/mol

| smiles = CNC(=C[N+](=O)[O-])NCCSCc1ccc(o1)CN(C)C

| InChI = 1/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3

| InChIKey = VMXUWOKSQNHOCA-UHFFFAOYAP

| StdInChI = 1S/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3

| StdInChIKey = VMXUWOKSQNHOCA-UHFFFAOYSA-N

}}


রেনিটিডিন (ইংরেজি: Ranitidine) হচ্ছে এমন একটি ওষুধ যা গ্যাস্ট্রিক এসিড উৎপাদন কমাতে ব্যবহার করা হয়। [১] এটা পেপ্টিক আলসার, গ্যাস্ট্রইসোফেজিয়াল রিফ্লাক্স রোগ জলিনজার-এলিসন সিন্ড্রোম রোগের চিকিৎসায় ব্যবহৃত হয়। [১] হাইভস বা আরটিকেরিয়ার চিকিৎসায় উপকার পাবার প্রমাণ রয়েছে।[২] এটা মুখে এবং মাংসপেশিতে বা শিরায় ইনজেকশন এর মাধ্যমে দেয়া হয়। [১]


প্রধান পার্শ্বপ্রতিক্রিয়াসমুহ হলো মাথাব্যথা, ইনজেকশনের জায়গায় ব্যথা। গুরুতর পার্শ্বপ্রতিক্রিয়া হচ্ছে লিভারে সমস্যা, হার্টরেট কমে যাওয়া, পাকস্থলীর ক্যান্সারজনিত উপসর্গগুলো বুঝতে না পারা। [১] এটা ক্লস্ট্রিডিয়াম ডেফিসিল কোলাইটিসের ঝুঁকি বাড়ায়। [৩] এটা সাধারণত গর্ভাবস্থায় নিরাপদ। রেনিটিডিন হলো H2 হিস্টামিন রিসেপ্টর অ্যান্টাগনিস্ট যা হিস্টামিন কে ব্লক করে ফলে পাকস্থলীর প্যারাইটাল কোষ থেকে বেশি এসিড বের হতে পারেনা। [১]


গ্লাক্সো ফার্মা যা এখন গ্লাক্সোস্মিথক্লাইন এর অংশ ১৯৭৬ সালে রেনিটিডিন আবিষ্কার করে। [৪][৫] এটা বিশ্ব স্বাস্থ্য সংস্থার জরুরি ওষুধের তালিকায় স্থান পেয়েছে এবং প্রাথমিক স্বাস্থ্যসেবায় অত্যন্ত গুরুত্বপূর্ণ ওষুধ হিসেবে বিবেচিত হয়। [৬] এটা এখন জেনেরিক মেডিসিন হিসেবে সহজলভ্য। [৭]

১৯৮১ সালে প্রথমবার রেনিটিডিন বাজারে ছাড়া হয় এবং ১৯৮৭ সালের মধ্যে এটি বাজারে বিক্রীত ওষুধের মধ্যে শীর্ষস্থান দখল করে। পরবর্তীতে ওমিপ্রাজল (যা একটি প্রোটন পাম্প ইনহিবিটর) শীর্ষস্থান দখল করে।[৮]

তথ্যসূত্র[সম্পাদনা]

  1. "Ranitidine"। The American Society of Health-System Pharmac ists। সংগ্রহের তারিখ ডিসে ১, ২০১৫ 
  2. Fedorowicz, Z; van Zuuren, EJ; Hu, N (১৪ মার্চ ২০১২)। "Histamine H2-receptor antagonists for urticaria."। The Cochrane database of systematic reviews3: CD008596। doi:10.1002/14651858.CD008596.pub2PMID 22419335 
  3. Tleyjeh, IM; Abdulhak, AB; Riaz; Garbati, MA; Al-Tannir, M; Alasmari, FA; Alghamdi, M; Khan, AR; Erwin, PJ; Sutton, AJ; Baddour, LM (২০১৩)। "The association between histamine 2 receptor antagonist use and Clostridium difficile infection: a systematic review and meta-analysis."PLOS ONE8 (3): e56498। doi:10.1371/journal.pone.0056498PMID 23469173পিএমসি 3587620অবাধে প্রবেশযোগ্য  অজানা প্যারামিটার |fir st3= উপেক্ষা করা হয়েছে (সাহায্য)
  4. Fischer, Janos (২০১০)। Analogue-based Drug Discovery II। John Wiley & Sons। পৃষ্ঠা 4। আইএসবিএন 9783527632121 
  5. Hara, Takuji (২০০৩)। Innovation in the pharmaceutical industry the process of drug discovery and development। Cheltenham, U.K.: Edward Elgar। পৃষ্ঠা 94। আইএসবিএন 9781843765660 
  6. "WHO Model List of EssentialMedicines" (PDF)World Health Organization। অক্টোবর ২০১৩। সংগ্রহের তারিখ ২২ এপ্রিল ২০১৪ 
  7. "Ranitidine"International Drug Price Indicator Guide। ১০ মে ২০১৭ তারিখে মূল থেকে আর্কাইভ করা। সংগ্রহের তারিখ ১ ডিসেম্বর ২০১৫ 
  8. Pelot, Daniel, (M.D.). "Digestive System : New Drug for Heartburn". The New Book of Knowledge : Medicine & Health, Grolier : Danbury, Connecticut. 1990. p.262. আইএসবিএন ০-৭১৭২-৮২৪৪-৯. Library of Congress 82-645223

বহিঃসংযোগ[সম্পাদনা]

টেমপ্লেট:H2-রিসেপ্টর অ্যান্টাগনিস্ট

বিষয়শ্রেণীঃ H2-রিসেপ্টর অ্যান্টাগনিস্ট